Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 18422-53-2, Name is 1,2:4,5-Di-O-Isopropylidene-Beta-D-Erythro-2,3-Hexodiulo-2,6-Pyranose, SMILES is O=C1[C@@]2(OC[C@]3([H])[C@@]1([H])OC(C)(O3)C)OC(C)(OC2)C, belongs to dioxoles compound. In a document, author is Wang, Qiang, introduce the new discover, HPLC of Formula: C12H18O6.
Crystal structure of (E)-ethyl 2-(2-(2-(2,4-dinitrophenyl)hydrazono)-2-phenylethyl)-2,5-dimethyl-7-phenylbenzo[d][1,3]dioxole-4-carboxylate, C32H27N4O8
C32H27N4O8, triclinic, P (1) over bar (no. 2), a = 10.085(2) angstrom, b = 11.302(2) angstrom, c = 13.269(3) angstrom, alpha = 80.76(3)degrees, beta = 78.81(3)degrees, gamma = 82.30(3)degrees, V = 1456.1 angstrom(3), Z = 2, R-gt(F) = 0.0691, wR(ref)(F-2) = 0.1756, T = 293 K. [GRAPHICS] .
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 18422-53-2 is helpful to your research. HPLC of Formula: C12H18O6.
Reference:
1,3-Benzodioxole – Wikipedia,
,Dioxole | C3H4O2 – PubChem