Simple exploration of 29836-26-8

The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 29836-26-8 is helpful to your research. Quality Control of Octyl ¦Â-D-glucopyranoside.

Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 29836-26-8, Name is Octyl ¦Â-D-glucopyranoside, SMILES is CCCCCCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O, belongs to dioxoles compound. In a document, author is SICHERI, FV, introduce the new discover, Quality Control of Octyl ¦Â-D-glucopyranoside.

STRUCTURE OF 5-(2-HYDROXYETHOXY)-6-[1-(4-METHOXYPHENYL)ETHYL]-1,3-BENZODIOXOLE

C18H20O5, M(r) = 316.35, orthorhombic, Pbca, a = 16.800 (2), b = 20.071 (2), c = 9.429 (1) angstrom, V = 3179.4 (5) angstrom3, Z = 8, D(m) = 1.36 (7), D(x) = 1.322 g cm-3, lambda(Cu Kalpha) = 1.54178 angstrom, mu = 7.53 cm-1, F(000) = 1344, T = 296 K, final R = 0.045, wR = 0.057 for 1695 unique reflections. This compound structurally resembles podophyllotoxin in that it contains a fused dioxole and phenyl ring system, but lacks the cyclohexyl and lactone rings. Whereas the unfused phenyl ring in podophyllotoxin contains three methoxy groups in the para and meta positions, the title compound contains only one in the para position.

The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 29836-26-8 is helpful to your research. Quality Control of Octyl ¦Â-D-glucopyranoside.

Reference:
1,3-Benzodioxole – Wikipedia,
,Dioxole | C3H4O2 – PubChem